ChemNet > CAS > 423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
| Naam product |
(1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol |
| Engelse naam |
(1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol; |
| MF |
C8H10N2OS |
| Molecuulgewicht |
182.2428 |
| InChI |
InChI=1/C8H10N2OS/c1-5-7-3-6(4-11)12-8(7)10(2)9-5/h3,11H,4H2,1-2H3 |
| CAS-nummer |
423769-75-9 |
| Moleculaire Structuur |
![423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol](https://images-a.chemnet.com/suppliers/chembase/173/17339.gif)
|
| Dichtheid |
1.4g/cm3 |
| Smeltpunt |
133℃ |
| Kookpunt |
351.2°C at 760 mmHg |
| Brekingsindex |
1.69 |
| Vlampunt |
166.2°C |
| Dampdruk |
1.55E-05mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
